C17H24ClN3O2S — CID 24838174
2-N-[4-(4-aminophenyl)sulfonylphenyl]-1-N,1-N-dimethylpropane-1,2-diamine;hydrochloride (PubChem CID 24838174) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is 2-N-[4-(4-aminophenyl)sulfonylphenyl]-1-N,1-N-dimethylpropane-1,2-diamine;hydrochloride.
| Compound Name | 2-N-[4-(4-aminophenyl)sulfonylphenyl]-1-N,1-N-dimethylpropane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 24838174 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-N-[4-(4-aminophenyl)sulfonylphenyl]-1-N,1-N-dimethylpropane-1,2-diamine;hydrochloride |
| SMILES | CC(CN(C)C)Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1.Cl |
| InChI | InChI=1S/C17H23N3O2S.ClH/c1-13(12-20(2)3)19-15-6-10-17(11-7-15)23(21,22)16-8-4-14(18)5-9-16;/h4-11,13,19H,12,18H2,1-3H3;1H |
| InChIKey | XJGNLXPJUNMZQM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|