C21H18N6 — CID 171440251
4-N,4-N-dimethyl-1-N-(4,8,13,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaen-9-yl)benzene-1,4-diamine (PubChem CID 171440251) has the molecular formula C21H18N6 and a molecular weight of 354.42 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-(4,8,13,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaen-9-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-1-N-(4,8,13,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaen-9-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 171440251 |
| Molecular Formula | C21H18N6 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-(4,8,13,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaen-9-yl)benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2nc3ccncc3c3[nH]c4ccncc4c23)cc1 |
| InChI | InChI=1S/C21H18N6/c1-27(2)14-5-3-13(4-6-14)24-21-19-15-11-22-9-7-17(15)25-20(19)16-12-23-10-8-18(16)26-21/h3-12,25H,1-2H3,(H,24,26) |
| InChIKey | ZIDDKUBPVCVPOH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|