C19H17N5O2 — CID 170683356
5-[4-(dimethylamino)anilino]-3H-pyrrolo[2,3-c][2,7]naphthyridine-2-carboxylic acid (PubChem CID 170683356) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 5-[4-(dimethylamino)anilino]-3H-pyrrolo[2,3-c][2,7]naphthyridine-2-carboxylic acid.
| Compound Name | 5-[4-(dimethylamino)anilino]-3H-pyrrolo[2,3-c][2,7]naphthyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 170683356 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 5-[4-(dimethylamino)anilino]-3H-pyrrolo[2,3-c][2,7]naphthyridine-2-carboxylic acid |
| SMILES | CN(C)c1ccc(Nc2nc3[nH]c(C(=O)O)cc3c3ccncc23)cc1 |
| InChI | InChI=1S/C19H17N5O2/c1-24(2)12-5-3-11(4-6-12)21-18-15-10-20-8-7-13(15)14-9-16(19(25)26)22-17(14)23-18/h3-10H,1-2H3,(H,25,26)(H2,21,22,23) |
| InChIKey | KHHOYTSDOXAYJC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|