C21H18N4O6S — CID 171406098
4-[4-(dimethylsulfamoyl)anilino]-1H-pyrrolo[3,2-c]quinoline-2,7-dicarboxylic acid (PubChem CID 171406098) has the molecular formula C21H18N4O6S and a molecular weight of 454.46 g/mol. Its IUPAC name is 4-[4-(dimethylsulfamoyl)anilino]-1H-pyrrolo[3,2-c]quinoline-2,7-dicarboxylic acid.
| Compound Name | 4-[4-(dimethylsulfamoyl)anilino]-1H-pyrrolo[3,2-c]quinoline-2,7-dicarboxylic acid |
|---|---|
| PubChem CID | 171406098 |
| Molecular Formula | C21H18N4O6S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-[4-(dimethylsulfamoyl)anilino]-1H-pyrrolo[3,2-c]quinoline-2,7-dicarboxylic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(Nc2nc3cc(C(=O)O)ccc3c3[nH]c(C(=O)O)cc23)cc1 |
| InChI | InChI=1S/C21H18N4O6S/c1-25(2)32(30,31)13-6-4-12(5-7-13)22-19-15-10-17(21(28)29)23-18(15)14-8-3-11(20(26)27)9-16(14)24-19/h3-10,23H,1-2H3,(H,22,24)(H,26,27)(H,28,29) |
| InChIKey | RBPDQNHHXAUIFE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 152.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |