C26H13N3O4 — CID 171441362
6-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-ylmethylidene)cyclopenta[b]pyrazine-5,7-dione (PubChem CID 171441362) has the molecular formula C26H13N3O4 and a molecular weight of 431.41 g/mol. Its IUPAC name is 6-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-ylmethylidene)cyclopenta[b]pyrazine-5,7-dione.
| Compound Name | 6-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-ylmethylidene)cyclopenta[b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 171441362 |
| Molecular Formula | C26H13N3O4 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 6-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-ylmethylidene)cyclopenta[b]pyrazine-5,7-dione |
| SMILES | O=C1C(=Cc2cc3c4c(c2)Oc2ccccc2N4c2ccccc2O3)C(=O)c2nccnc21 |
| InChI | InChI=1S/C26H13N3O4/c30-25-15(26(31)23-22(25)27-9-10-28-23)11-14-12-20-24-21(13-14)33-19-8-4-2-6-17(19)29(24)16-5-1-3-7-18(16)32-20/h1-13H |
| InChIKey | DMNKGYSEIIUXOE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|