C28H11F4NO4 — CID 171441408
2-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-ylmethylidene)-4,5,6,7-tetrafluoroindene-1,3-dione (PubChem CID 171441408) has the molecular formula C28H11F4NO4 and a molecular weight of 501.39 g/mol. Its IUPAC name is 2-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-ylmethylidene)-4,5,6,7-tetrafluoroindene-1,3-dione.
| Compound Name | 2-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-ylmethylidene)-4,5,6,7-tetrafluoroindene-1,3-dione |
|---|---|
| PubChem CID | 171441408 |
| Molecular Formula | C28H11F4NO4 |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 2-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-ylmethylidene)-4,5,6,7-tetrafluoroindene-1,3-dione |
| SMILES | O=C1C(=Cc2cc3c4c(c2)Oc2ccccc2N4c2ccccc2O3)C(=O)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C28H11F4NO4/c29-22-20-21(23(30)25(32)24(22)31)28(35)13(27(20)34)9-12-10-18-26-19(11-12)37-17-8-4-2-6-15(17)33(26)14-5-1-3-7-16(14)36-18/h1-11H |
| InChIKey | GEWSNJVCLBHMPS-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|