C57H56N4O2 — CID 171441926
6,18-bis(3,6-ditert-butylcarbazol-9-yl)-12-methyl-10,14-dioxa-7,17-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene (PubChem CID 171441926) has the molecular formula C57H56N4O2 and a molecular weight of 829.10 g/mol. Its IUPAC name is 6,18-bis(3,6-ditert-butylcarbazol-9-yl)-12-methyl-10,14-dioxa-7,17-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene.
| Compound Name | 6,18-bis(3,6-ditert-butylcarbazol-9-yl)-12-methyl-10,14-dioxa-7,17-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 171441926 |
| Molecular Formula | C57H56N4O2 |
| Molecular Weight | 829.10 g/mol |
| Exact Mass | 828.44 |
| IUPAC Name | 6,18-bis(3,6-ditert-butylcarbazol-9-yl)-12-methyl-10,14-dioxa-7,17-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene |
| SMILES | Cc1c2oc3cnc(-n4c5ccc(C(C)(C)C)cc5c5cc(C(C)(C)C)ccc54)cc3c2cc2c1oc1cnc(-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)ccc43)cc12 |
| InChI | InChI=1S/C57H56N4O2/c1-31-52-42(40-27-50(58-29-48(40)62-52)60-44-18-14-32(54(2,3)4)22-36(44)37-23-33(55(5,6)7)15-19-45(37)60)26-43-41-28-51(59-30-49(41)63-53(31)43)61-46-20-16-34(56(8,9)10)24-38(46)39-25-35(57(11,12)13)17-21-47(39)61/h14-30H,1-13H3 |
| InChIKey | OXYJIGDVRNLJKD-UHFFFAOYSA-N |
| XLogP | 15.97 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.10 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |