C24H36FN3O3+2 — CID 171442461
2-(2-fluorophenyl)ethyl-[[2-[(2R)-2-hydroxy-3-(4-methylpiperazin-4-ium-1-yl)propoxy]-4-methoxyphenyl]methyl]azanium (PubChem CID 171442461) has the molecular formula C24H36FN3O3+2 and a molecular weight of 433.57 g/mol. Its IUPAC name is 2-(2-fluorophenyl)ethyl-[[2-[(2R)-2-hydroxy-3-(4-methylpiperazin-4-ium-1-yl)propoxy]-4-methoxyphenyl]methyl]azanium.
| Compound Name | 2-(2-fluorophenyl)ethyl-[[2-[(2R)-2-hydroxy-3-(4-methylpiperazin-4-ium-1-yl)propoxy]-4-methoxyphenyl]methyl]azanium |
|---|---|
| PubChem CID | 171442461 |
| Molecular Formula | C24H36FN3O3+2 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 2-(2-fluorophenyl)ethyl-[[2-[(2R)-2-hydroxy-3-(4-methylpiperazin-4-ium-1-yl)propoxy]-4-methoxyphenyl]methyl]azanium |
| SMILES | COc1ccc(C[NH2+]CCc2ccccc2F)c(OC[C@H](O)CN2CC[NH+](C)CC2)c1 |
| InChI | InChI=1S/C24H34FN3O3/c1-27-11-13-28(14-12-27)17-21(29)18-31-24-15-22(30-2)8-7-20(24)16-26-10-9-19-5-3-4-6-23(19)25/h3-8,15,21,26,29H,9-14,16-18H2,1-2H3/p+2/t21-/m1/s1 |
| InChIKey | QKAQGLLFZNFADB-OAQYLSRUSA-P |
| XLogP | -0.29 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|