C23H29ClN6O3S — CID 171442771
N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-[ethyl-[(5-methyl-1H-indazol-7-yl)sulfonyl]amino]acetamide (PubChem CID 171442771) has the molecular formula C23H29ClN6O3S and a molecular weight of 505.04 g/mol. Its IUPAC name is N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-[ethyl-[(5-methyl-1H-indazol-7-yl)sulfonyl]amino]acetamide.
| Compound Name | N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-[ethyl-[(5-methyl-1H-indazol-7-yl)sulfonyl]amino]acetamide |
|---|---|
| PubChem CID | 171442771 |
| Molecular Formula | C23H29ClN6O3S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-[ethyl-[(5-methyl-1H-indazol-7-yl)sulfonyl]amino]acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(N2CCN(C)CC2)c(Cl)c1)S(=O)(=O)c1cc(C)cc2cn[nH]c12 |
| InChI | InChI=1S/C23H29ClN6O3S/c1-4-30(34(32,33)21-12-16(2)11-17-14-25-27-23(17)21)15-22(31)26-18-5-6-20(19(24)13-18)29-9-7-28(3)8-10-29/h5-6,11-14H,4,7-10,15H2,1-3H3,(H,25,27)(H,26,31) |
| InChIKey | DTVBESVMAPBDCZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|