C22H25ClN4O5S — CID 171395570
N-(3-chloro-4-morpholin-4-ylphenyl)-2-[methyl-[(5-methyl-2-oxo-1,3-dihydroindol-7-yl)sulfonyl]amino]acetamide (PubChem CID 171395570) has the molecular formula C22H25ClN4O5S and a molecular weight of 492.99 g/mol. Its IUPAC name is N-(3-chloro-4-morpholin-4-ylphenyl)-2-[methyl-[(5-methyl-2-oxo-1,3-dihydroindol-7-yl)sulfonyl]amino]acetamide.
| Compound Name | N-(3-chloro-4-morpholin-4-ylphenyl)-2-[methyl-[(5-methyl-2-oxo-1,3-dihydroindol-7-yl)sulfonyl]amino]acetamide |
|---|---|
| PubChem CID | 171395570 |
| Molecular Formula | C22H25ClN4O5S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-(3-chloro-4-morpholin-4-ylphenyl)-2-[methyl-[(5-methyl-2-oxo-1,3-dihydroindol-7-yl)sulfonyl]amino]acetamide |
| SMILES | Cc1cc2c(c(S(=O)(=O)N(C)CC(=O)Nc3ccc(N4CCOCC4)c(Cl)c3)c1)NC(=O)C2 |
| InChI | InChI=1S/C22H25ClN4O5S/c1-14-9-15-11-20(28)25-22(15)19(10-14)33(30,31)26(2)13-21(29)24-16-3-4-18(17(23)12-16)27-5-7-32-8-6-27/h3-4,9-10,12H,5-8,11,13H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | NZHGRTTUZPFLHP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|