C23H29N5O4S — CID 171442889
2-[ethyl-[(5-methyl-1H-indazol-7-yl)sulfonyl]amino]-N-(3-methyl-4-morpholin-4-ylphenyl)acetamide (PubChem CID 171442889) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is 2-[ethyl-[(5-methyl-1H-indazol-7-yl)sulfonyl]amino]-N-(3-methyl-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[ethyl-[(5-methyl-1H-indazol-7-yl)sulfonyl]amino]-N-(3-methyl-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 171442889 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-[ethyl-[(5-methyl-1H-indazol-7-yl)sulfonyl]amino]-N-(3-methyl-4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(N2CCOCC2)c(C)c1)S(=O)(=O)c1cc(C)cc2cn[nH]c12 |
| InChI | InChI=1S/C23H29N5O4S/c1-4-28(33(30,31)21-12-16(2)11-18-14-24-26-23(18)21)15-22(29)25-19-5-6-20(17(3)13-19)27-7-9-32-10-8-27/h5-6,11-14H,4,7-10,15H2,1-3H3,(H,24,26)(H,25,29) |
| InChIKey | XKSXAVDLSBCIMK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|