C22H35N5O4S — CID 171904422
2-[methyl-[(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-7-yl)sulfonyl]amino]-N-(3-methyl-4-morpholin-4-ylphenyl)acetamide (PubChem CID 171904422) has the molecular formula C22H35N5O4S and a molecular weight of 465.62 g/mol. Its IUPAC name is 2-[methyl-[(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-7-yl)sulfonyl]amino]-N-(3-methyl-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[methyl-[(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-7-yl)sulfonyl]amino]-N-(3-methyl-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 171904422 |
| Molecular Formula | C22H35N5O4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-[methyl-[(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-7-yl)sulfonyl]amino]-N-(3-methyl-4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CN(C)S(=O)(=O)C2CC(C)CC3CNNC32)ccc1N1CCOCC1 |
| InChI | InChI=1S/C22H35N5O4S/c1-15-10-17-13-23-25-22(17)20(11-15)32(29,30)26(3)14-21(28)24-18-4-5-19(16(2)12-18)27-6-8-31-9-7-27/h4-5,12,15,17,20,22-23,25H,6-11,13-14H2,1-3H3,(H,24,28) |
| InChIKey | LXNXMEMOWXOMOW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|