C16H16N6 — CID 171446026
2-N,6-dimethyl-4-N-(3-pyrazin-2-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 171446026) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is 2-N,6-dimethyl-4-N-(3-pyrazin-2-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,6-dimethyl-4-N-(3-pyrazin-2-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 171446026 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-N,6-dimethyl-4-N-(3-pyrazin-2-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | CNc1nc(C)cc(Nc2cccc(-c3cnccn3)c2)n1 |
| InChI | InChI=1S/C16H16N6/c1-11-8-15(22-16(17-2)20-11)21-13-5-3-4-12(9-13)14-10-18-6-7-19-14/h3-10H,1-2H3,(H2,17,20,21,22) |
| InChIKey | GLUOCAOMDYOJQC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |