C10H12N4S — CID 80850538
2-N,6-dimethyl-4-N-thiophen-3-ylpyrimidine-2,4-diamine (PubChem CID 80850538) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-N,6-dimethyl-4-N-thiophen-3-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N,6-dimethyl-4-N-thiophen-3-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80850538 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-N,6-dimethyl-4-N-thiophen-3-ylpyrimidine-2,4-diamine |
| SMILES | CNc1nc(C)cc(Nc2ccsc2)n1 |
| InChI | InChI=1S/C10H12N4S/c1-7-5-9(14-10(11-2)12-7)13-8-3-4-15-6-8/h3-6H,1-2H3,(H2,11,12,13,14) |
| InChIKey | HAHXJLHEWOERRY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |