C36H22N6O — CID 171448072
10-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-phenylquinazolino[1,2-c]quinazolin-13-one (PubChem CID 171448072) has the molecular formula C36H22N6O and a molecular weight of 554.61 g/mol. Its IUPAC name is 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-phenylquinazolino[1,2-c]quinazolin-13-one.
| Compound Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-phenylquinazolino[1,2-c]quinazolin-13-one |
|---|---|
| PubChem CID | 171448072 |
| Molecular Formula | C36H22N6O |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-phenylquinazolino[1,2-c]quinazolin-13-one |
| SMILES | O=c1nc2c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3nc(-c3ccccc3)n2c2ccccc12 |
| InChI | InChI=1S/C36H22N6O/c43-36-27-18-10-11-19-30(27)42-34(25-16-8-3-9-17-25)37-29-21-20-26(22-28(29)35(42)41-36)33-39-31(23-12-4-1-5-13-23)38-32(40-33)24-14-6-2-7-15-24/h1-22H |
| InChIKey | NJTFINJYPGGQRL-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 85.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|