C36H21N7O — CID 165126102
21-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9,17,25-tetrazahexacyclo[15.8.0.02,10.03,8.011,16.019,24]pentacosa-1(25),3,5,7,9,11,13,15,19(24),20,22-undecaen-18-one (PubChem CID 165126102) has the molecular formula C36H21N7O and a molecular weight of 567.61 g/mol. Its IUPAC name is 21-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9,17,25-tetrazahexacyclo[15.8.0.02,10.03,8.011,16.019,24]pentacosa-1(25),3,5,7,9,11,13,15,19(24),20,22-undecaen-18-one.
| Compound Name | 21-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9,17,25-tetrazahexacyclo[15.8.0.02,10.03,8.011,16.019,24]pentacosa-1(25),3,5,7,9,11,13,15,19(24),20,22-undecaen-18-one |
|---|---|
| PubChem CID | 165126102 |
| Molecular Formula | C36H21N7O |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 21-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9,17,25-tetrazahexacyclo[15.8.0.02,10.03,8.011,16.019,24]pentacosa-1(25),3,5,7,9,11,13,15,19(24),20,22-undecaen-18-one |
| SMILES | O=c1c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2nc2n1c1ccccc1c1nc3ccccc3n12 |
| InChI | InChI=1S/C36H21N7O/c44-35-26-21-24(33-40-31(22-11-3-1-4-12-22)39-32(41-33)23-13-5-2-6-14-23)19-20-27(26)38-36-42-30-18-10-8-16-28(30)37-34(42)25-15-7-9-17-29(25)43(35)36/h1-21H |
| InChIKey | LAVQYCXEWRIKGB-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 90.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|