C31H19N5O — CID 171606304
6-(4,6-diphenyl-1,3,5-triazin-2-yl)isoquinolino[1,2-b]quinazolin-8-one (PubChem CID 171606304) has the molecular formula C31H19N5O and a molecular weight of 477.53 g/mol. Its IUPAC name is 6-(4,6-diphenyl-1,3,5-triazin-2-yl)isoquinolino[1,2-b]quinazolin-8-one.
| Compound Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)isoquinolino[1,2-b]quinazolin-8-one |
|---|---|
| PubChem CID | 171606304 |
| Molecular Formula | C31H19N5O |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)isoquinolino[1,2-b]quinazolin-8-one |
| SMILES | O=c1c2ccccc2nc2c3ccccc3cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)n12 |
| InChI | InChI=1S/C31H19N5O/c37-31-24-17-9-10-18-25(24)32-30-23-16-8-7-15-22(23)19-26(36(30)31)29-34-27(20-11-3-1-4-12-20)33-28(35-29)21-13-5-2-6-14-21/h1-19H |
| InChIKey | MUNRCARMTMALIS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 73.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|