C22H32O3SSi — CID 171457450
ethyl 4-oxo-3-[2-tri(propan-2-yl)silylethynyl]-6,7-dihydro-5H-2-benzothiophene-1-carboxylate (PubChem CID 171457450) has the molecular formula C22H32O3SSi and a molecular weight of 404.65 g/mol. Its IUPAC name is ethyl 4-oxo-3-[2-tri(propan-2-yl)silylethynyl]-6,7-dihydro-5H-2-benzothiophene-1-carboxylate.
| Compound Name | ethyl 4-oxo-3-[2-tri(propan-2-yl)silylethynyl]-6,7-dihydro-5H-2-benzothiophene-1-carboxylate |
|---|---|
| PubChem CID | 171457450 |
| Molecular Formula | C22H32O3SSi |
| Molecular Weight | 404.65 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | ethyl 4-oxo-3-[2-tri(propan-2-yl)silylethynyl]-6,7-dihydro-5H-2-benzothiophene-1-carboxylate |
| SMILES | CCOC(=O)c1sc(C#C[Si](C(C)C)(C(C)C)C(C)C)c2c1CCCC2=O |
| InChI | InChI=1S/C22H32O3SSi/c1-8-25-22(24)21-17-10-9-11-18(23)20(17)19(26-21)12-13-27(14(2)3,15(4)5)16(6)7/h14-16H,8-11H2,1-7H3 |
| InChIKey | IDIWMZCIUSPAPP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|