C25H37NO3SSi — CID 171457487
ethyl (5E)-5-(dimethylaminomethylidene)-4-oxo-3-[2-tri(propan-2-yl)silylethynyl]-6,7-dihydro-2-benzothiophene-1-carboxylate (PubChem CID 171457487) has the molecular formula C25H37NO3SSi and a molecular weight of 459.73 g/mol. Its IUPAC name is ethyl (5E)-5-(dimethylaminomethylidene)-4-oxo-3-[2-tri(propan-2-yl)silylethynyl]-6,7-dihydro-2-benzothiophene-1-carboxylate.
| Compound Name | ethyl (5E)-5-(dimethylaminomethylidene)-4-oxo-3-[2-tri(propan-2-yl)silylethynyl]-6,7-dihydro-2-benzothiophene-1-carboxylate |
|---|---|
| PubChem CID | 171457487 |
| Molecular Formula | C25H37NO3SSi |
| Molecular Weight | 459.73 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | ethyl (5E)-5-(dimethylaminomethylidene)-4-oxo-3-[2-tri(propan-2-yl)silylethynyl]-6,7-dihydro-2-benzothiophene-1-carboxylate |
| SMILES | CCOC(=O)c1sc(C#C[Si](C(C)C)(C(C)C)C(C)C)c2c1CC/C(=C\N(C)C)C2=O |
| InChI | InChI=1S/C25H37NO3SSi/c1-10-29-25(28)24-20-12-11-19(15-26(8)9)23(27)22(20)21(30-24)13-14-31(16(2)3,17(4)5)18(6)7/h15-18H,10-12H2,1-9H3/b19-15+ |
| InChIKey | RSBQGZZEHMNQHO-XDJHFCHBSA-N |
| XLogP | 6.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.73 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|