C21H22O5S — CID 70034707
ethyl (5E)-5-(ethoxymethylidene)-3-(4-methylphenoxy)-4-oxo-6,7-dihydro-2-benzothiophene-1-carboxylate (PubChem CID 70034707) has the molecular formula C21H22O5S and a molecular weight of 386.47 g/mol. Its IUPAC name is ethyl (5E)-5-(ethoxymethylidene)-3-(4-methylphenoxy)-4-oxo-6,7-dihydro-2-benzothiophene-1-carboxylate.
| Compound Name | ethyl (5E)-5-(ethoxymethylidene)-3-(4-methylphenoxy)-4-oxo-6,7-dihydro-2-benzothiophene-1-carboxylate |
|---|---|
| PubChem CID | 70034707 |
| Molecular Formula | C21H22O5S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | ethyl (5E)-5-(ethoxymethylidene)-3-(4-methylphenoxy)-4-oxo-6,7-dihydro-2-benzothiophene-1-carboxylate |
| SMILES | CCO/C=C1\CCc2c(C(=O)OCC)sc(Oc3ccc(C)cc3)c2C1=O |
| InChI | InChI=1S/C21H22O5S/c1-4-24-12-14-8-11-16-17(18(14)22)21(27-19(16)20(23)25-5-2)26-15-9-6-13(3)7-10-15/h6-7,9-10,12H,4-5,8,11H2,1-3H3/b14-12+ |
| InChIKey | UIGOLDKKZWZMMM-WYMLVPIESA-N |
| XLogP | 5.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|