C39H35N2O+ — CID 171459027
1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methyl-7-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)-4a,9a-dihydro-[1]benzofuro[2,3-c]pyridin-2-ium (PubChem CID 171459027) has the molecular formula C39H35N2O+ and a molecular weight of 555.77 g/mol. Its IUPAC name is 1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methyl-7-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)-4a,9a-dihydro-[1]benzofuro[2,3-c]pyridin-2-ium.
| Compound Name | 1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methyl-7-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)-4a,9a-dihydro-[1]benzofuro[2,3-c]pyridin-2-ium |
|---|---|
| PubChem CID | 171459027 |
| Molecular Formula | C39H35N2O+ |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | 1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methyl-7-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)-4a,9a-dihydro-[1]benzofuro[2,3-c]pyridin-2-ium |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1ccc2c(c1)OC1C(c3cc(C(C)(C)C)c4ccccc4c3C)=[N+](C)C=CC21 |
| InChI | InChI=1S/C39H35N2O/c1-24-26-12-6-7-13-27(26)33(39(2,3)4)23-32(24)37-38-31(20-21-40(37)5)30-19-18-25(22-36(30)42-38)41-34-16-10-8-14-28(34)29-15-9-11-17-35(29)41/h6-23,31,38H,1-5H3/q+1/i8D,9D,10D,11D,14D,15D,16D,17D |
| InChIKey | IHFJTXOACJRWGK-GWBHXDFLSA-N |
| XLogP | 9.05 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|