C33H29N2O+ — CID 171459074
8-(1,8-dideuteriocarbazol-9-yl)-2-methyl-1-(2,3,5-trimethylphenyl)-4a,9a-dihydro-[1]benzofuro[2,3-c]pyridin-2-ium (PubChem CID 171459074) has the molecular formula C33H29N2O+ and a molecular weight of 471.62 g/mol. Its IUPAC name is 8-(1,8-dideuteriocarbazol-9-yl)-2-methyl-1-(2,3,5-trimethylphenyl)-4a,9a-dihydro-[1]benzofuro[2,3-c]pyridin-2-ium.
| Compound Name | 8-(1,8-dideuteriocarbazol-9-yl)-2-methyl-1-(2,3,5-trimethylphenyl)-4a,9a-dihydro-[1]benzofuro[2,3-c]pyridin-2-ium |
|---|---|
| PubChem CID | 171459074 |
| Molecular Formula | C33H29N2O+ |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 8-(1,8-dideuteriocarbazol-9-yl)-2-methyl-1-(2,3,5-trimethylphenyl)-4a,9a-dihydro-[1]benzofuro[2,3-c]pyridin-2-ium |
| SMILES | [2H]c1cccc2c3cccc([2H])c3n(-c3cccc4c3OC3C(c5cc(C)cc(C)c5C)=[N+](C)C=CC43)c12 |
| InChI | InChI=1S/C33H29N2O/c1-20-18-21(2)22(3)27(19-20)31-33-26(16-17-34(31)4)25-12-9-15-30(32(25)36-33)35-28-13-7-5-10-23(28)24-11-6-8-14-29(24)35/h5-19,26,33H,1-4H3/q+1/i13D,14D |
| InChIKey | DNBXXTWRVPIECV-FLZZRPEZSA-N |
| XLogP | 7.21 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|