C48H38BN3 — CID 171467116
8-[3,5-bis(4-methylphenyl)phenyl]-4,18-dimethyl-14-(4-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-11-carbonitrile (PubChem CID 171467116) has the molecular formula C48H38BN3 and a molecular weight of 667.67 g/mol. Its IUPAC name is 8-[3,5-bis(4-methylphenyl)phenyl]-4,18-dimethyl-14-(4-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-11-carbonitrile.
| Compound Name | 8-[3,5-bis(4-methylphenyl)phenyl]-4,18-dimethyl-14-(4-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-11-carbonitrile |
|---|---|
| PubChem CID | 171467116 |
| Molecular Formula | C48H38BN3 |
| Molecular Weight | 667.67 g/mol |
| Exact Mass | 667.32 |
| IUPAC Name | 8-[3,5-bis(4-methylphenyl)phenyl]-4,18-dimethyl-14-(4-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-11-carbonitrile |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)cc(N3c4ccc(C)cc4B4c5cc(C)ccc5N(c5ccc(C)cc5)c5cc(C#N)cc3c54)c2)cc1 |
| InChI | InChI=1S/C48H38BN3/c1-30-6-14-36(15-7-30)38-26-39(37-16-8-31(2)9-17-37)28-41(27-38)52-45-21-13-34(5)23-43(45)49-42-22-33(4)12-20-44(42)51(40-18-10-32(3)11-19-40)46-24-35(29-50)25-47(52)48(46)49/h6-28H,1-5H3 |
| InChIKey | VVYLLHDUFIKXAP-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.67 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|