C28H15N3S2 — CID 171468672
(Z)-N-isocyano-2-(7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)fluoren-9-imine (PubChem CID 171468672) has the molecular formula C28H15N3S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is (Z)-N-isocyano-2-(7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)fluoren-9-imine.
| Compound Name | (Z)-N-isocyano-2-(7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)fluoren-9-imine |
|---|---|
| PubChem CID | 171468672 |
| Molecular Formula | C28H15N3S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | (Z)-N-isocyano-2-(7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)fluoren-9-imine |
| SMILES | [C-]#[N+]/N=C1/c2ccccc2-c2ccc(-c3cc4c(s3)c3sccc3n4-c3ccccc3)cc21 |
| InChI | InChI=1S/C28H15N3S2/c1-29-30-26-21-10-6-5-9-19(21)20-12-11-17(15-22(20)26)25-16-24-28(33-25)27-23(13-14-32-27)31(24)18-7-3-2-4-8-18/h2-16H/b30-26- |
| InChIKey | BJOXKMPKTYOAQN-BXVZCJGGSA-N |
| XLogP | 8.23 |
| TPSA | 21.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|