C41H38ClF3N2O5 — CID 171469787
(5S)-5-[2-(4-carboxyphenyl)ethyl-[2-[2-[[6-chloro-4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydroquinoline-2-carboxylic acid (PubChem CID 171469787) has the molecular formula C41H38ClF3N2O5 and a molecular weight of 731.21 g/mol. Its IUPAC name is (5S)-5-[2-(4-carboxyphenyl)ethyl-[2-[2-[[6-chloro-4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | (5S)-5-[2-(4-carboxyphenyl)ethyl-[2-[2-[[6-chloro-4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 171469787 |
| Molecular Formula | C41H38ClF3N2O5 |
| Molecular Weight | 731.21 g/mol |
| Exact Mass | 730.24 |
| IUPAC Name | (5S)-5-[2-(4-carboxyphenyl)ethyl-[2-[2-[[6-chloro-4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydroquinoline-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCN(CCc2ccccc2OCC2(C(F)(F)F)C=CC(c3ccccc3)=CC2Cl)[C@H]2CCCc3nc(C(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C41H38ClF3N2O5/c42-37-25-31(28-7-2-1-3-8-28)19-22-40(37,41(43,44)45)26-52-36-12-5-4-9-29(36)21-24-47(23-20-27-13-15-30(16-14-27)38(48)49)35-11-6-10-33-32(35)17-18-34(46-33)39(50)51/h1-5,7-9,12-19,22,25,35,37H,6,10-11,20-21,23-24,26H2,(H,48,49)(H,50,51)/t35-,37?,40?/m0/s1 |
| InChIKey | KZCLEAFFZDKLCD-ITDMGYIVSA-N |
| XLogP | 8.83 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.21 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|