C33H39NO5S — CID 118040485
5-[4-carboxybutyl-[2-[2-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylmethoxy)phenyl]ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 118040485) has the molecular formula C33H39NO5S and a molecular weight of 561.74 g/mol. Its IUPAC name is 5-[4-carboxybutyl-[2-[2-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylmethoxy)phenyl]ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | 5-[4-carboxybutyl-[2-[2-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylmethoxy)phenyl]ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 118040485 |
| Molecular Formula | C33H39NO5S |
| Molecular Weight | 561.74 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 5-[4-carboxybutyl-[2-[2-(4,5,6,7-tetrahydro-1-benzothiophen-2-ylmethoxy)phenyl]ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)CCCCN(CCc1ccccc1OCc1cc2c(s1)CCCC2)C1CCCc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C33H39NO5S/c35-32(36)14-5-6-18-34(29-11-7-10-24-20-26(33(37)38)15-16-28(24)29)19-17-23-8-1-3-12-30(23)39-22-27-21-25-9-2-4-13-31(25)40-27/h1,3,8,12,15-16,20-21,29H,2,4-7,9-11,13-14,17-19,22H2,(H,35,36)(H,37,38) |
| InChIKey | LSNHWNFUCHCVRF-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.74 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|