C28H37NO5 — CID 118179072
ethyl 5-[(5-ethoxy-5-oxopentyl)-[2-(2-hydroxyphenyl)ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate (PubChem CID 118179072) has the molecular formula C28H37NO5 and a molecular weight of 467.61 g/mol. Its IUPAC name is ethyl 5-[(5-ethoxy-5-oxopentyl)-[2-(2-hydroxyphenyl)ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate.
| Compound Name | ethyl 5-[(5-ethoxy-5-oxopentyl)-[2-(2-hydroxyphenyl)ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 118179072 |
| Molecular Formula | C28H37NO5 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | ethyl 5-[(5-ethoxy-5-oxopentyl)-[2-(2-hydroxyphenyl)ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)CCCCN(CCc1ccccc1O)C1CCCc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C28H37NO5/c1-3-33-27(31)14-7-8-18-29(19-17-21-10-5-6-13-26(21)30)25-12-9-11-22-20-23(15-16-24(22)25)28(32)34-4-2/h5-6,10,13,15-16,20,25,30H,3-4,7-9,11-12,14,17-19H2,1-2H3 |
| InChIKey | LBUXTNDSTRBAGX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|