C36H41NO5 — CID 118040739
5-[4-carboxybutyl-[2-[2-[[4-(3-methylbut-1-ynyl)phenyl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 118040739) has the molecular formula C36H41NO5 and a molecular weight of 567.73 g/mol. Its IUPAC name is 5-[4-carboxybutyl-[2-[2-[[4-(3-methylbut-1-ynyl)phenyl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | 5-[4-carboxybutyl-[2-[2-[[4-(3-methylbut-1-ynyl)phenyl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 118040739 |
| Molecular Formula | C36H41NO5 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | 5-[4-carboxybutyl-[2-[2-[[4-(3-methylbut-1-ynyl)phenyl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | CC(C)C#Cc1ccc(COc2ccccc2CCN(CCCCC(=O)O)C2CCCc3cc(C(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C36H41NO5/c1-26(2)13-14-27-15-17-28(18-16-27)25-42-34-11-4-3-8-29(34)21-23-37(22-6-5-12-35(38)39)33-10-7-9-30-24-31(36(40)41)19-20-32(30)33/h3-4,8,11,15-20,24,26,33H,5-7,9-10,12,21-23,25H2,1-2H3,(H,38,39)(H,40,41) |
| InChIKey | VZWRMEIEEGGTFO-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|