C38H46O5 — CID 138658630
5-[7-carboxy-1-[2-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethoxy]phenyl]heptan-3-yl]-4-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 138658630) has the molecular formula C38H46O5 and a molecular weight of 582.78 g/mol. Its IUPAC name is 5-[7-carboxy-1-[2-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethoxy]phenyl]heptan-3-yl]-4-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | 5-[7-carboxy-1-[2-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethoxy]phenyl]heptan-3-yl]-4-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 138658630 |
| Molecular Formula | C38H46O5 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | 5-[7-carboxy-1-[2-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethoxy]phenyl]heptan-3-yl]-4-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)cc2c1C(C(CCCCC(=O)O)CCc1ccccc1OCCc1ccc3c(c1)CCCC3)CCC2 |
| InChI | InChI=1S/C38H46O5/c1-26-23-33(38(41)42)25-32-13-8-14-34(37(26)32)29(10-5-7-16-36(39)40)19-20-30-11-4-6-15-35(30)43-22-21-27-17-18-28-9-2-3-12-31(28)24-27/h4,6,11,15,17-18,23-25,29,34H,2-3,5,7-10,12-14,16,19-22H2,1H3,(H,39,40)(H,41,42) |
| InChIKey | OYGFOTQDZMVASC-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|