C35H41NO7 — CID 118040437
methyl 5-[2-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)phenyl]ethyl-(5-methoxy-5-oxopentyl)amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate (PubChem CID 118040437) has the molecular formula C35H41NO7 and a molecular weight of 587.71 g/mol. Its IUPAC name is methyl 5-[2-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)phenyl]ethyl-(5-methoxy-5-oxopentyl)amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate.
| Compound Name | methyl 5-[2-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)phenyl]ethyl-(5-methoxy-5-oxopentyl)amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 118040437 |
| Molecular Formula | C35H41NO7 |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | methyl 5-[2-[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)phenyl]ethyl-(5-methoxy-5-oxopentyl)amino]-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
| SMILES | COC(=O)CCCCN(CCc1ccccc1OCc1ccc2c(c1)OCCO2)C1CCCc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C35H41NO7/c1-39-34(37)12-5-6-18-36(30-10-7-9-27-23-28(35(38)40-2)14-15-29(27)30)19-17-26-8-3-4-11-31(26)43-24-25-13-16-32-33(22-25)42-21-20-41-32/h3-4,8,11,13-16,22-23,30H,5-7,9-10,12,17-21,24H2,1-2H3 |
| InChIKey | TZMPHOWVRKLLKI-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|