C40H39N3O7S — CID 118040689
methyl 5-[(2-nitrophenyl)sulfonyl-[2-[2-[[4-(2-phenylethyl)phenyl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydroquinoline-2-carboxylate (PubChem CID 118040689) has the molecular formula C40H39N3O7S and a molecular weight of 705.83 g/mol. Its IUPAC name is methyl 5-[(2-nitrophenyl)sulfonyl-[2-[2-[[4-(2-phenylethyl)phenyl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydroquinoline-2-carboxylate.
| Compound Name | methyl 5-[(2-nitrophenyl)sulfonyl-[2-[2-[[4-(2-phenylethyl)phenyl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 118040689 |
| Molecular Formula | C40H39N3O7S |
| Molecular Weight | 705.83 g/mol |
| Exact Mass | 705.25 |
| IUPAC Name | methyl 5-[(2-nitrophenyl)sulfonyl-[2-[2-[[4-(2-phenylethyl)phenyl]methoxy]phenyl]ethyl]amino]-5,6,7,8-tetrahydroquinoline-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)CCCC2N(CCc1ccccc1OCc1ccc(CCc2ccccc2)cc1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C40H39N3O7S/c1-49-40(44)35-25-24-33-34(41-35)13-9-15-36(33)42(51(47,48)39-17-8-6-14-37(39)43(45)46)27-26-32-12-5-7-16-38(32)50-28-31-22-20-30(21-23-31)19-18-29-10-3-2-4-11-29/h2-8,10-12,14,16-17,20-25,36H,9,13,15,18-19,26-28H2,1H3 |
| InChIKey | OXQACHWMPNLKTQ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 128.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.83 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|