C28H32N4O6S — CID 150103906
[2-methyl-4-[4-[[(2-nitrophenyl)sulfonyl-(5,6,7,8-tetrahydroquinolin-7-yl)amino]methyl]phenyl]butan-2-yl] carbamate (PubChem CID 150103906) has the molecular formula C28H32N4O6S and a molecular weight of 552.65 g/mol. Its IUPAC name is [2-methyl-4-[4-[[(2-nitrophenyl)sulfonyl-(5,6,7,8-tetrahydroquinolin-7-yl)amino]methyl]phenyl]butan-2-yl] carbamate.
| Compound Name | [2-methyl-4-[4-[[(2-nitrophenyl)sulfonyl-(5,6,7,8-tetrahydroquinolin-7-yl)amino]methyl]phenyl]butan-2-yl] carbamate |
|---|---|
| PubChem CID | 150103906 |
| Molecular Formula | C28H32N4O6S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | [2-methyl-4-[4-[[(2-nitrophenyl)sulfonyl-(5,6,7,8-tetrahydroquinolin-7-yl)amino]methyl]phenyl]butan-2-yl] carbamate |
| SMILES | CC(C)(CCc1ccc(CN(C2CCc3cccnc3C2)S(=O)(=O)c2ccccc2[N+](=O)[O-])cc1)OC(N)=O |
| InChI | InChI=1S/C28H32N4O6S/c1-28(2,38-27(29)33)16-15-20-9-11-21(12-10-20)19-31(23-14-13-22-6-5-17-30-24(22)18-23)39(36,37)26-8-4-3-7-25(26)32(34)35/h3-12,17,23H,13-16,18-19H2,1-2H3,(H2,29,33) |
| InChIKey | DVVJJLZXJHIZND-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 145.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|