C21H26N2O6S — CID 146442445
N-(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-nitro-N-propylbenzenesulfonamide (PubChem CID 146442445) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is N-(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-nitro-N-propylbenzenesulfonamide.
| Compound Name | N-(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-nitro-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 146442445 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-nitro-N-propylbenzenesulfonamide |
| SMILES | CCCN(C1CCc2cc(OC)c(OC)cc2C1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N2O6S/c1-4-11-22(30(26,27)21-8-6-5-7-18(21)23(24)25)17-10-9-15-13-19(28-2)20(29-3)14-16(15)12-17/h5-8,13-14,17H,4,9-12H2,1-3H3 |
| InChIKey | DYHFSJUDAKXDAU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|