C26H22F5N3O — CID 171471479
6-[4-(4-methylpiperazin-1-yl)phenyl]-3-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]furo[3,2-b]pyridine (PubChem CID 171471479) has the molecular formula C26H22F5N3O and a molecular weight of 487.47 g/mol. Its IUPAC name is 6-[4-(4-methylpiperazin-1-yl)phenyl]-3-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]furo[3,2-b]pyridine.
| Compound Name | 6-[4-(4-methylpiperazin-1-yl)phenyl]-3-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 171471479 |
| Molecular Formula | C26H22F5N3O |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 6-[4-(4-methylpiperazin-1-yl)phenyl]-3-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]furo[3,2-b]pyridine |
| SMILES | CN1CCN(c2ccc(-c3cnc4c(-c5cccc(C(F)(F)C(F)(F)F)c5)coc4c3)cc2)CC1 |
| InChI | InChI=1S/C26H22F5N3O/c1-33-9-11-34(12-10-33)21-7-5-17(6-8-21)19-14-23-24(32-15-19)22(16-35-23)18-3-2-4-20(13-18)25(27,28)26(29,30)31/h2-8,13-16H,9-12H2,1H3 |
| InChIKey | IJGLSAFRFJZQIN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|