C25H23N3O2 — CID 171471470
3-[6-[4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-b]pyridin-3-yl]benzaldehyde (PubChem CID 171471470) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-[6-[4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-b]pyridin-3-yl]benzaldehyde.
| Compound Name | 3-[6-[4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-b]pyridin-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 171471470 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-[6-[4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-b]pyridin-3-yl]benzaldehyde |
| SMILES | CN1CCN(c2ccc(-c3cnc4c(-c5cccc(C=O)c5)coc4c3)cc2)CC1 |
| InChI | InChI=1S/C25H23N3O2/c1-27-9-11-28(12-10-27)22-7-5-19(6-8-22)21-14-24-25(26-15-21)23(17-30-24)20-4-2-3-18(13-20)16-29/h2-8,13-17H,9-12H2,1H3 |
| InChIKey | PKRSPRIWFBACPN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|