C21H21N5O — CID 171471589
3-(1-methylpyrazol-3-yl)-6-(4-piperazin-1-ylphenyl)furo[3,2-b]pyridine (PubChem CID 171471589) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-(1-methylpyrazol-3-yl)-6-(4-piperazin-1-ylphenyl)furo[3,2-b]pyridine.
| Compound Name | 3-(1-methylpyrazol-3-yl)-6-(4-piperazin-1-ylphenyl)furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 171471589 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-(1-methylpyrazol-3-yl)-6-(4-piperazin-1-ylphenyl)furo[3,2-b]pyridine |
| SMILES | Cn1ccc(-c2coc3cc(-c4ccc(N5CCNCC5)cc4)cnc23)n1 |
| InChI | InChI=1S/C21H21N5O/c1-25-9-6-19(24-25)18-14-27-20-12-16(13-23-21(18)20)15-2-4-17(5-3-15)26-10-7-22-8-11-26/h2-6,9,12-14,22H,7-8,10-11H2,1H3 |
| InChIKey | OSOLQKLLJZQHJM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |