C25H25N5OS — CID 87280143
4-methyl-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-[1,3]thiazolo[5,4-b]pyridin-6-yl]benzaldehyde (PubChem CID 87280143) has the molecular formula C25H25N5OS and a molecular weight of 443.58 g/mol. Its IUPAC name is 4-methyl-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-[1,3]thiazolo[5,4-b]pyridin-6-yl]benzaldehyde.
| Compound Name | 4-methyl-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-[1,3]thiazolo[5,4-b]pyridin-6-yl]benzaldehyde |
|---|---|
| PubChem CID | 87280143 |
| Molecular Formula | C25H25N5OS |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 4-methyl-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-[1,3]thiazolo[5,4-b]pyridin-6-yl]benzaldehyde |
| SMILES | Cc1ccc(C=O)cc1-c1cnc2sc(Nc3ccc(N4CCN(C)CC4)cc3)nc2c1 |
| InChI | InChI=1S/C25H25N5OS/c1-17-3-4-18(16-31)13-22(17)19-14-23-24(26-15-19)32-25(28-23)27-20-5-7-21(8-6-20)30-11-9-29(2)10-12-30/h3-8,13-16H,9-12H2,1-2H3,(H,27,28) |
| InChIKey | YDALTQSMDGWWNG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|