C13H21N3O4S3 — CID 171471816
Tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]piperidine-1-carboxylate (PubChem CID 171471816) has the molecular formula C13H21N3O4S3 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]piperidine-1-carboxylate.
| Compound Name | Tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171471816 |
| Molecular Formula | C13H21N3O4S3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfanyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)SC2=NC=C(S2)S(=O)(=O)N |
| InChI | InChI=1S/C13H21N3O4S3/c1-13(2,3)20-12(17)16-6-4-9(5-7-16)21-11-15-8-10(22-11)23(14,18)19/h8-9H,4-7H2,1-3H3,(H2,14,18,19) |
| InChIKey | PCCFEJJPWSWJKC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 165.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | 522 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|