C24H18FN3O — CID 171476521
7'-fluoro-1'-methyl-11-phenylspiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-9,3'-indole]-2'-one (PubChem CID 171476521) has the molecular formula C24H18FN3O and a molecular weight of 383.43 g/mol. Its IUPAC name is 7'-fluoro-1'-methyl-11-phenylspiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-9,3'-indole]-2'-one.
| Compound Name | 7'-fluoro-1'-methyl-11-phenylspiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-9,3'-indole]-2'-one |
|---|---|
| PubChem CID | 171476521 |
| Molecular Formula | C24H18FN3O |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 7'-fluoro-1'-methyl-11-phenylspiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-9,3'-indole]-2'-one |
| SMILES | CN1C(=O)C2(N=C(c3ccccc3)N3CCc4cccc2c43)c2cccc(F)c21 |
| InChI | InChI=1S/C24H18FN3O/c1-27-21-18(11-6-12-19(21)25)24(23(27)29)17-10-5-9-15-13-14-28(20(15)17)22(26-24)16-7-3-2-4-8-16/h2-12H,13-14H2,1H3 |
| InChIKey | MJCCBUCAYAASJK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |