C25H21N3O2 — CID 171476525
5-methoxy-1'-methyl-11-phenylspiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),10-tetraene-9,3'-indole]-2'-one (PubChem CID 171476525) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5-methoxy-1'-methyl-11-phenylspiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),10-tetraene-9,3'-indole]-2'-one.
| Compound Name | 5-methoxy-1'-methyl-11-phenylspiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),10-tetraene-9,3'-indole]-2'-one |
|---|---|
| PubChem CID | 171476525 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 5-methoxy-1'-methyl-11-phenylspiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),10-tetraene-9,3'-indole]-2'-one |
| SMILES | COc1ccc2c3c1CCN3C(c1ccccc1)=NC21C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C25H21N3O2/c1-27-20-11-7-6-10-18(20)25(24(27)29)19-12-13-21(30-2)17-14-15-28(22(17)19)23(26-25)16-8-4-3-5-9-16/h3-13H,14-15H2,1-2H3 |
| InChIKey | NSGFIWQINYVXSO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |