C30H23N3O — CID 171476532
1'-methyl-11-(4-phenylphenyl)spiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-9,3'-indole]-2'-one (PubChem CID 171476532) has the molecular formula C30H23N3O and a molecular weight of 441.53 g/mol. Its IUPAC name is 1'-methyl-11-(4-phenylphenyl)spiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-9,3'-indole]-2'-one.
| Compound Name | 1'-methyl-11-(4-phenylphenyl)spiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-9,3'-indole]-2'-one |
|---|---|
| PubChem CID | 171476532 |
| Molecular Formula | C30H23N3O |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1'-methyl-11-(4-phenylphenyl)spiro[1,10-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraene-9,3'-indole]-2'-one |
| SMILES | CN1C(=O)C2(N=C(c3ccc(-c4ccccc4)cc3)N3CCc4cccc2c43)c2ccccc21 |
| InChI | InChI=1S/C30H23N3O/c1-32-26-13-6-5-11-24(26)30(29(32)34)25-12-7-10-22-18-19-33(27(22)25)28(31-30)23-16-14-21(15-17-23)20-8-3-2-4-9-20/h2-17H,18-19H2,1H3 |
| InChIKey | NBVONFLOQAWHBG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |