About 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate
2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate (PubChem CID 171476626) has the molecular formula C12H10BrN5O2
and a molecular weight of 336.15 g/mol. Its IUPAC name is 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate.
Molecular Properties
| Compound Name | 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate |
| PubChem CID | 171476626 |
| Molecular Formula | C12H10BrN5O2 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate |
| SMILES | C=CC(COC(=O)C(=[N+]=[N-])c1ccc(Br)cc1)N=[N+]=[N-] |
| InChI | InChI=1S/C12H10BrN5O2/c1-2-10(17-18-15)7-20-12(19)11(16-14)8-3-5-9(13)6-4-8/h2-6,10H,1,7H2 |
| InChIKey | SSURBFZAWDXDSD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate?
The IUPAC name of 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate (CID 171476626) is 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate.
What is the SMILES notation for 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate?
The canonical SMILES for 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate is C=CC(COC(=O)C(=[N+]=[N-])c1ccc(Br)cc1)N=[N+]=[N-].
What is the InChIKey of 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate?
The InChIKey is SSURBFZAWDXDSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrN5O2/c1-2-10(17-18-15)7-20-12(19)11(16-14)8-3-5-9(13)6-4-8/h2-6,10H,1,7H2.
What are the key properties of 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate?
2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate has a molecular weight of 336.15 g/mol, XLogP of 2.88, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azidobut-3-enyl 2-(4-bromophenyl)-2-diazoacetate is sourced from PubChem (CID 171476626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).