C10H12O3S — CID 171476794
(3,5-dimethyl-4-methylsulfanylphenyl) hydrogen carbonate (PubChem CID 171476794) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is (3,5-dimethyl-4-methylsulfanylphenyl) hydrogen carbonate.
| Compound Name | (3,5-dimethyl-4-methylsulfanylphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 171476794 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | (3,5-dimethyl-4-methylsulfanylphenyl) hydrogen carbonate |
| SMILES | CSc1c(C)cc(OC(=O)O)cc1C |
| InChI | InChI=1S/C10H12O3S/c1-6-4-8(13-10(11)12)5-7(2)9(6)14-3/h4-5H,1-3H3,(H,11,12) |
| InChIKey | FIGUEMUMGZYXAD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|