C12H15O2S- — CID 140706026
3-(3,5-dimethyl-4-methylsulfanylphenyl)propanoate (PubChem CID 140706026) has the molecular formula C12H15O2S- and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-methylsulfanylphenyl)propanoate.
| Compound Name | 3-(3,5-dimethyl-4-methylsulfanylphenyl)propanoate |
|---|---|
| PubChem CID | 140706026 |
| Molecular Formula | C12H15O2S- |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-(3,5-dimethyl-4-methylsulfanylphenyl)propanoate |
| SMILES | CSc1c(C)cc(CCC(=O)[O-])cc1C |
| InChI | InChI=1S/C12H16O2S/c1-8-6-10(4-5-11(13)14)7-9(2)12(8)15-3/h6-7H,4-5H2,1-3H3,(H,13,14)/p-1 |
| InChIKey | MFOKKFVUOXLWBD-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |