C15H22O3S — CID 175627944
3-methylsulfanylpropyl 3-(4-hydroxy-3,5-dimethylphenyl)propanoate (PubChem CID 175627944) has the molecular formula C15H22O3S and a molecular weight of 282.41 g/mol. Its IUPAC name is 3-methylsulfanylpropyl 3-(4-hydroxy-3,5-dimethylphenyl)propanoate.
| Compound Name | 3-methylsulfanylpropyl 3-(4-hydroxy-3,5-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 175627944 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-methylsulfanylpropyl 3-(4-hydroxy-3,5-dimethylphenyl)propanoate |
| SMILES | CSCCCOC(=O)CCc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C15H22O3S/c1-11-9-13(10-12(2)15(11)17)5-6-14(16)18-7-4-8-19-3/h9-10,17H,4-8H2,1-3H3 |
| InChIKey | KPFBZPRDJPZSAQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|