C42H64N2O8 — CID 139646415
2-[[2-[2-[3-[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanoyloxy]ethylamino]-2-oxoacetyl]amino]ethyl 3-[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanoate (PubChem CID 139646415) has the molecular formula C42H64N2O8 and a molecular weight of 724.98 g/mol. Its IUPAC name is 2-[[2-[2-[3-[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanoyloxy]ethylamino]-2-oxoacetyl]amino]ethyl 3-[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanoate.
| Compound Name | 2-[[2-[2-[3-[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanoyloxy]ethylamino]-2-oxoacetyl]amino]ethyl 3-[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 139646415 |
| Molecular Formula | C42H64N2O8 |
| Molecular Weight | 724.98 g/mol |
| Exact Mass | 724.47 |
| IUPAC Name | 2-[[2-[2-[3-[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanoyloxy]ethylamino]-2-oxoacetyl]amino]ethyl 3-[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]propanoate |
| SMILES | Cc1cc(CCC(=O)OCCNC(=O)C(=O)NCCOC(=O)CCc2cc(C)c(O)c(C(C)(C)CC(C)(C)C)c2)cc(C(C)(C)CC(C)(C)C)c1O |
| InChI | InChI=1S/C42H64N2O8/c1-27-21-29(23-31(35(27)47)41(9,10)25-39(3,4)5)13-15-33(45)51-19-17-43-37(49)38(50)44-18-20-52-34(46)16-14-30-22-28(2)36(48)32(24-30)42(11,12)26-40(6,7)8/h21-24,47-48H,13-20,25-26H2,1-12H3,(H,43,49)(H,44,50) |
| InChIKey | SXQZWOMJVSGRLD-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.98 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|