C20H32O3 — CID 67623426
octyl 4-(4-hydroxy-3,5-dimethylphenyl)butanoate (PubChem CID 67623426) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is octyl 4-(4-hydroxy-3,5-dimethylphenyl)butanoate.
| Compound Name | octyl 4-(4-hydroxy-3,5-dimethylphenyl)butanoate |
|---|---|
| PubChem CID | 67623426 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | octyl 4-(4-hydroxy-3,5-dimethylphenyl)butanoate |
| SMILES | CCCCCCCCOC(=O)CCCc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C20H32O3/c1-4-5-6-7-8-9-13-23-19(21)12-10-11-18-14-16(2)20(22)17(3)15-18/h14-15,22H,4-13H2,1-3H3 |
| InChIKey | OVKMMAOCMMYPMW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|