C29H52O3S — CID 87969151
octadecyl 2-sulfanylacetate;2,4,6-trimethylphenol (PubChem CID 87969151) has the molecular formula C29H52O3S and a molecular weight of 480.80 g/mol. Its IUPAC name is octadecyl 2-sulfanylacetate;2,4,6-trimethylphenol.
| Compound Name | octadecyl 2-sulfanylacetate;2,4,6-trimethylphenol |
|---|---|
| PubChem CID | 87969151 |
| Molecular Formula | C29H52O3S |
| Molecular Weight | 480.80 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | octadecyl 2-sulfanylacetate;2,4,6-trimethylphenol |
| SMILES | CCCCCCCCCCCCCCCCCCOC(=O)CS.Cc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C20H40O2S.C9H12O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-20(21)19-23;1-6-4-7(2)9(10)8(3)5-6/h23H,2-19H2,1H3;4-5,10H,1-3H3 |
| InChIKey | RZYPHIUYZHTGJS-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.80 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|