C29H40O5 — CID 20678205
[10-(4-hydroxy-3,5-dimethylphenyl)-8-oxodecyl] 3-(4-hydroxy-3,5-dimethylphenyl)propanoate (PubChem CID 20678205) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is [10-(4-hydroxy-3,5-dimethylphenyl)-8-oxodecyl] 3-(4-hydroxy-3,5-dimethylphenyl)propanoate.
| Compound Name | [10-(4-hydroxy-3,5-dimethylphenyl)-8-oxodecyl] 3-(4-hydroxy-3,5-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 20678205 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | [10-(4-hydroxy-3,5-dimethylphenyl)-8-oxodecyl] 3-(4-hydroxy-3,5-dimethylphenyl)propanoate |
| SMILES | Cc1cc(CCC(=O)CCCCCCCOC(=O)CCc2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C29H40O5/c1-20-16-24(17-21(2)28(20)32)11-13-26(30)10-8-6-5-7-9-15-34-27(31)14-12-25-18-22(3)29(33)23(4)19-25/h16-19,32-33H,5-15H2,1-4H3 |
| InChIKey | AQQQTNAYCAGLLW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|