About [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate
[4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate (PubChem CID 21115354) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate.
Molecular Properties
| Compound Name | [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate |
| PubChem CID | 21115354 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate |
| SMILES | CC(=O)N(C)C(=O)Oc1cc(C)c(N(C)C)c(C)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-9-7-12(8-10(2)13(9)15(4)5)19-14(18)16(6)11(3)17/h7-8H,1-6H3 |
| InChIKey | RRTKZOWUBCJRQF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate?
The IUPAC name of [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate (CID 21115354) is [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate.
What is the SMILES notation for [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate?
The canonical SMILES for [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate is CC(=O)N(C)C(=O)Oc1cc(C)c(N(C)C)c(C)c1.
What is the InChIKey of [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate?
The InChIKey is RRTKZOWUBCJRQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-9-7-12(8-10(2)13(9)15(4)5)19-14(18)16(6)11(3)17/h7-8H,1-6H3.
What are the key properties of [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate?
[4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate has a molecular weight of 264.32 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(dimethylamino)-3,5-dimethylphenyl] N-acetyl-N-methylcarbamate is sourced from PubChem (CID 21115354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).